C30H29N3O6S — CID 126280544
2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126280544) has the molecular formula C30H29N3O6S and a molecular weight of 559.64 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126280544 |
| Molecular Formula | C30H29N3O6S |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 2-[(5Z)-5-[[4-[2-(4-ethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)COc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4cccc(C)c4)C3=O)cc2OC)cc1 |
| InChI | InChI=1S/C30H29N3O6S/c1-4-20-8-11-22(12-9-20)31-28(35)18-39-24-13-10-21(15-25(24)38-3)16-26-29(36)33(30(37)40-26)17-27(34)32-23-7-5-6-19(2)14-23/h5-16H,4,17-18H2,1-3H3,(H,31,35)(H,32,34)/b26-16- |
| InChIKey | WMRRTOOANITGEL-QQXSKIMKSA-N |
| XLogP | 5.26 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|