C29H25BrClN3O6S — CID 126189219
2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 126189219) has the molecular formula C29H25BrClN3O6S and a molecular weight of 658.96 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126189219 |
| Molecular Formula | C29H25BrClN3O6S |
| Molecular Weight | 658.96 g/mol |
| Exact Mass | 657.03 |
| IUPAC Name | 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(OCC(=O)Nc4ccc(Br)c(Cl)c4)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C29H25BrClN3O6S/c1-3-17-4-7-19(8-5-17)32-26(35)15-34-28(37)25(41-29(34)38)13-18-6-11-23(24(12-18)39-2)40-16-27(36)33-20-9-10-21(30)22(31)14-20/h4-14H,3,15-16H2,1-2H3,(H,32,35)(H,33,36)/b25-13+ |
| InChIKey | PLSPHIIQLYZVGW-DHRITJCHSA-N |
| XLogP | 6.37 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|