C31H23BrClN3O6S — CID 126259343
2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide (PubChem CID 126259343) has the molecular formula C31H23BrClN3O6S and a molecular weight of 680.96 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126259343 |
| Molecular Formula | C31H23BrClN3O6S |
| Molecular Weight | 680.96 g/mol |
| Exact Mass | 679.02 |
| IUPAC Name | 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc4ccccc34)C2=O)ccc1OCC(=O)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C31H23BrClN3O6S/c1-41-26-13-18(9-12-25(26)42-17-29(38)34-20-10-11-22(32)23(33)15-20)14-27-30(39)36(31(40)43-27)16-28(37)35-24-8-4-6-19-5-2-3-7-21(19)24/h2-15H,16-17H2,1H3,(H,34,38)(H,35,37)/b27-14+ |
| InChIKey | ATRWWHVMTBOILG-MZJWZYIUSA-N |
| XLogP | 6.96 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.96 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|