C24H22BrClN2O7S — CID 124641950
propan-2-yl 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124641950) has the molecular formula C24H22BrClN2O7S and a molecular weight of 597.87 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124641950 |
| Molecular Formula | C24H22BrClN2O7S |
| Molecular Weight | 597.87 g/mol |
| Exact Mass | 596.00 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[4-[2-(4-bromo-3-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)OC(C)C)C2=O)ccc1OCC(=O)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C24H22BrClN2O7S/c1-13(2)35-22(30)11-28-23(31)20(36-24(28)32)9-14-4-7-18(19(8-14)33-3)34-12-21(29)27-15-5-6-16(25)17(26)10-15/h4-10,13H,11-12H2,1-3H3,(H,27,29)/b20-9+ |
| InChIKey | QLOXYUMOUGTLPI-AWQFTUOYSA-N |
| XLogP | 5.12 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|