C32H33N3O6S — CID 126344472
2-[(5E)-5-[[3-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 126344472) has the molecular formula C32H33N3O6S and a molecular weight of 587.70 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126344472 |
| Molecular Formula | C32H33N3O6S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 2-[(5E)-5-[[3-ethoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(C(C)C)cc3)C2=O)ccc1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C32H33N3O6S/c1-5-40-27-16-22(9-14-26(27)41-19-30(37)34-25-8-6-7-21(4)15-25)17-28-31(38)35(32(39)42-28)18-29(36)33-24-12-10-23(11-13-24)20(2)3/h6-17,20H,5,18-19H2,1-4H3,(H,33,36)(H,34,37)/b28-17+ |
| InChIKey | IBISPLAYBVDBCJ-OGLMXYFKSA-N |
| XLogP | 6.21 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|