C28H22ClFN2O7S — CID 126158410
methyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126158410) has the molecular formula C28H22ClFN2O7S and a molecular weight of 585.01 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126158410 |
| Molecular Formula | C28H22ClFN2O7S |
| Molecular Weight | 585.01 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OCc4ccc(F)cc4)c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C28H22ClFN2O7S/c1-37-23-11-17(5-10-22(23)39-15-16-3-6-18(30)7-4-16)12-24-26(34)32(28(36)40-24)14-25(33)31-19-8-9-21(29)20(13-19)27(35)38-2/h3-13H,14-15H2,1-2H3,(H,31,33)/b24-12- |
| InChIKey | JECGBHHQKZQYJJ-MSXFZWOLSA-N |
| XLogP | 5.53 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.01 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|