C32H30ClFN2O7S — CID 126177459
butyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126177459) has the molecular formula C32H30ClFN2O7S and a molecular weight of 641.12 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126177459 |
| Molecular Formula | C32H30ClFN2O7S |
| Molecular Weight | 641.12 g/mol |
| Exact Mass | 640.14 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OCc4ccc(F)cc4)c(OCC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C32H30ClFN2O7S/c1-3-5-14-42-31(39)24-17-23(11-12-25(24)33)35-29(37)18-36-30(38)28(44-32(36)40)16-21-8-13-26(27(15-21)41-4-2)43-19-20-6-9-22(34)10-7-20/h6-13,15-17H,3-5,14,18-19H2,1-2H3,(H,35,37)/b28-16- |
| InChIKey | ZJUROQREDJSSRS-NTFVMDSBSA-N |
| XLogP | 7.09 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.12 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|