C28H29ClN2O9S — CID 126362606
propyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126362606) has the molecular formula C28H29ClN2O9S and a molecular weight of 605.07 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126362606 |
| Molecular Formula | C28H29ClN2O9S |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OCC(=O)OCC)c(OCC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C28H29ClN2O9S/c1-4-11-39-27(35)19-14-18(8-9-20(19)29)30-24(32)15-31-26(34)23(41-28(31)36)13-17-7-10-21(22(12-17)37-5-2)40-16-25(33)38-6-3/h7-10,12-14H,4-6,11,15-16H2,1-3H3,(H,30,32)/b23-13- |
| InChIKey | QDBBQVOPBUNWOJ-QRVIBDJDSA-N |
| XLogP | 4.92 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|