C26H27ClN2O6S — CID 126163583
propyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126163583) has the molecular formula C26H27ClN2O6S and a molecular weight of 531.03 g/mol. Its IUPAC name is propyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | propyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126163583 |
| Molecular Formula | C26H27ClN2O6S |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | propyl 5-[[2-[(5Z)-5-[(4-butoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | CCCCOc1ccc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OCCC)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H27ClN2O6S/c1-3-5-13-34-19-9-6-17(7-10-19)14-22-24(31)29(26(33)36-22)16-23(30)28-18-8-11-21(27)20(15-18)25(32)35-12-4-2/h6-11,14-15H,3-5,12-13,16H2,1-2H3,(H,28,30)/b22-14- |
| InChIKey | IHSIHCYNWGFLEQ-HMAPJEAMSA-N |
| XLogP | 5.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|