C22H17Cl3N2O5S — CID 126172305
propyl 2-chloro-5-[[2-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126172305) has the molecular formula C22H17Cl3N2O5S and a molecular weight of 527.81 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126172305 |
| Molecular Formula | C22H17Cl3N2O5S |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3c(Cl)cccc3Cl)C2=O)ccc1Cl |
| InChI | InChI=1S/C22H17Cl3N2O5S/c1-2-8-32-21(30)14-9-12(6-7-17(14)25)26-19(28)11-27-20(29)18(33-22(27)31)10-13-15(23)4-3-5-16(13)24/h3-7,9-10H,2,8,11H2,1H3,(H,26,28)/b18-10+ |
| InChIKey | CCWKEQZTKKLYKS-VCHYOVAHSA-N |
| XLogP | 5.89 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|