C22H17Cl2N3O7S — CID 126157747
propyl 2-chloro-5-[[2-[(5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126157747) has the molecular formula C22H17Cl2N3O7S and a molecular weight of 538.37 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126157747 |
| Molecular Formula | C22H17Cl2N3O7S |
| Molecular Weight | 538.37 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3cc([N+](=O)[O-])ccc3Cl)C2=O)ccc1Cl |
| InChI | InChI=1S/C22H17Cl2N3O7S/c1-2-7-34-21(30)15-10-13(3-5-17(15)24)25-19(28)11-26-20(29)18(35-22(26)31)9-12-8-14(27(32)33)4-6-16(12)23/h3-6,8-10H,2,7,11H2,1H3,(H,25,28)/b18-9- |
| InChIKey | BOCNJCTWZWREDA-NVMNQCDNSA-N |
| XLogP | 5.14 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|