C21H14Cl3N3O7S — CID 126204309
ethyl 2-chloro-5-[[2-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126204309) has the molecular formula C21H14Cl3N3O7S and a molecular weight of 558.78 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126204309 |
| Molecular Formula | C21H14Cl3N3O7S |
| Molecular Weight | 558.78 g/mol |
| Exact Mass | 556.96 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3cc([N+](=O)[O-])c(Cl)cc3Cl)C2=O)ccc1Cl |
| InChI | InChI=1S/C21H14Cl3N3O7S/c1-2-34-20(30)12-7-11(3-4-13(12)22)25-18(28)9-26-19(29)17(35-21(26)31)6-10-5-16(27(32)33)15(24)8-14(10)23/h3-8H,2,9H2,1H3,(H,25,28)/b17-6- |
| InChIKey | WRIYZUYDNGBBTP-FMQZQXMHSA-N |
| XLogP | 5.41 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.78 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|