C29H23ClN4O10S — CID 126158592
butyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126158592) has the molecular formula C29H23ClN4O10S and a molecular weight of 655.04 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126158592 |
| Molecular Formula | C29H23ClN4O10S |
| Molecular Weight | 655.04 g/mol |
| Exact Mass | 654.08 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccccc3Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C2=O)ccc1Cl |
| InChI | InChI=1S/C29H23ClN4O10S/c1-2-3-12-43-28(37)20-14-18(8-10-21(20)30)31-26(35)16-32-27(36)25(45-29(32)38)13-17-6-4-5-7-23(17)44-24-11-9-19(33(39)40)15-22(24)34(41)42/h4-11,13-15H,2-3,12,16H2,1H3,(H,31,35)/b25-13+ |
| InChIKey | DZGSMWHTRNYNJY-DHRITJCHSA-N |
| XLogP | 6.58 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.04 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|