C31H25ClF3N3O9S — CID 126156969
butyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126156969) has the molecular formula C31H25ClF3N3O9S and a molecular weight of 708.07 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126156969 |
| Molecular Formula | C31H25ClF3N3O9S |
| Molecular Weight | 708.07 g/mol |
| Exact Mass | 707.10 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5E)-5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(Oc4ccc(C(F)(F)F)cc4[N+](=O)[O-])c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C31H25ClF3N3O9S/c1-3-4-11-46-29(41)20-15-19(7-8-21(20)32)36-27(39)16-37-28(40)26(48-30(37)42)13-17-5-9-24(25(12-17)45-2)47-23-10-6-18(31(33,34)35)14-22(23)38(43)44/h5-10,12-15H,3-4,11,16H2,1-2H3,(H,36,39)/b26-13+ |
| InChIKey | DPRCUVLRJWVWGU-LGJNPRDNSA-N |
| XLogP | 7.70 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.07 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|