C29H23ClN4O11S — CID 126168246
propyl 2-chloro-5-[[2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126168246) has the molecular formula C29H23ClN4O11S and a molecular weight of 671.04 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126168246 |
| Molecular Formula | C29H23ClN4O11S |
| Molecular Weight | 671.04 g/mol |
| Exact Mass | 670.08 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c(OC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C29H23ClN4O11S/c1-3-10-44-28(37)19-13-17(5-7-20(19)30)31-26(35)15-32-27(36)25(46-29(32)38)12-16-4-8-23(24(11-16)43-2)45-22-9-6-18(33(39)40)14-21(22)34(41)42/h4-9,11-14H,3,10,15H2,1-2H3,(H,31,35)/b25-12+ |
| InChIKey | XUSLRCMIUZDDID-BRJLIKDPSA-N |
| XLogP | 6.20 |
| TPSA | 197.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.04 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|