C27H22N4O9S — CID 126281480
N-(3,5-dimethylphenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126281480) has the molecular formula C27H22N4O9S and a molecular weight of 578.56 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126281480 |
| Molecular Formula | C27H22N4O9S |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cc(C)cc(C)c3)C2=O)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H22N4O9S/c1-15-8-16(2)10-18(9-15)28-25(32)14-29-26(33)24(41-27(29)34)12-17-4-6-22(23(11-17)39-3)40-21-7-5-19(30(35)36)13-20(21)31(37)38/h4-13H,14H2,1-3H3,(H,28,32)/b24-12+ |
| InChIKey | ZYRJHXGOWGVUNY-WYMPLXKRSA-N |
| XLogP | 5.60 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|