C24H16N4O10S — CID 124667204
(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-[(2-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124667204) has the molecular formula C24H16N4O10S and a molecular weight of 552.48 g/mol. Its IUPAC name is (5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-[(2-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-[(2-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124667204 |
| Molecular Formula | C24H16N4O10S |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | (5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-[(2-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3ccccc3[N+](=O)[O-])C2=O)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16N4O10S/c1-37-21-10-14(6-8-20(21)38-19-9-7-16(26(31)32)12-18(19)28(35)36)11-22-23(29)25(24(30)39-22)13-15-4-2-3-5-17(15)27(33)34/h2-12H,13H2,1H3/b22-11+ |
| InChIKey | SIRNIHPVZKLHPC-SSDVNMTOSA-N |
| XLogP | 5.45 |
| TPSA | 185.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|