C31H21N4O9S- — CID 9498224
4-[[(5Z)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoate (PubChem CID 9498224) has the molecular formula C31H21N4O9S- and a molecular weight of 625.60 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoate.
| Compound Name | 4-[[(5Z)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 9498224 |
| Molecular Formula | C31H21N4O9S- |
| Molecular Weight | 625.60 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | 4-[[(5Z)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoate |
| SMILES | COc1cc(/C=C2\S/C(=N\c3ccccc3)N(Cc3ccc(C(=O)[O-])cc3)C2=O)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H22N4O9S/c1-43-27-15-20(9-13-26(27)44-25-14-12-23(34(39)40)17-24(25)35(41)42)16-28-29(36)33(18-19-7-10-21(11-8-19)30(37)38)31(45-28)32-22-5-3-2-4-6-22/h2-17H,18H2,1H3,(H,37,38)/p-1/b28-16-,32-31- |
| InChIKey | XUGUZBSBUFLANJ-GHMGMLMRSA-M |
| XLogP | 5.47 |
| TPSA | 177.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|