C20H15N3O10S — CID 124642333
methyl 2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124642333) has the molecular formula C20H15N3O10S and a molecular weight of 489.42 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124642333 |
| Molecular Formula | C20H15N3O10S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | methyl 2-[(5E)-5-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)S/C(=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)C1=O |
| InChI | InChI=1S/C20H15N3O10S/c1-31-16-7-11(8-17-19(25)21(20(26)34-17)10-18(24)32-2)3-5-15(16)33-14-6-4-12(22(27)28)9-13(14)23(29)30/h3-9H,10H2,1-2H3/b17-8+ |
| InChIKey | CNVNBRGDFXXQQQ-CAOOACKPSA-N |
| XLogP | 3.51 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|