C22H21N3O8S — CID 126220674
2-methylpropyl 2-[(5E)-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126220674) has the molecular formula C22H21N3O8S and a molecular weight of 487.49 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5E)-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5E)-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126220674 |
| Molecular Formula | C22H21N3O8S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-methylpropyl 2-[(5E)-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)OCC(C)C)C2=O)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C22H21N3O8S/c1-13(2)12-32-20(26)11-24-21(27)18(34-22(24)28)9-14-4-6-16(17(8-14)31-3)33-19-7-5-15(10-23-19)25(29)30/h4-10,13H,11-12H2,1-3H3/b18-9+ |
| InChIKey | VJXVYOJKVLTWLS-GIJQJNRQSA-N |
| XLogP | 4.03 |
| TPSA | 138.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|