C19H23NO7S — CID 126209110
2-methylpropyl 2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 126209110) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126209110 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-methylpropyl 2-[(5E)-2,4-dioxo-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1/SC(=O)N(CC(=O)OCC(C)C)C1=O |
| InChI | InChI=1S/C19H23NO7S/c1-11(2)10-27-17(21)9-20-18(22)16(28-19(20)23)7-12-6-14(25-4)15(26-5)8-13(12)24-3/h6-8,11H,9-10H2,1-5H3/b16-7+ |
| InChIKey | TVONVODEITZRTC-FRKPEAEDSA-N |
| XLogP | 2.95 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|