C18H18NO7S- — CID 7344939
2-[4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 7344939) has the molecular formula C18H18NO7S- and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7344939 |
| Molecular Formula | C18H18NO7S- |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)COC(=O)CN1C(=O)S/C(=C/c2ccc(OCC(=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C18H19NO7S/c1-11(2)9-26-16(22)8-19-17(23)14(27-18(19)24)7-12-3-5-13(6-4-12)25-10-15(20)21/h3-7,11H,8-10H2,1-2H3,(H,20,21)/p-1/b14-7+ |
| InChIKey | ZJOTULDSADURIM-VGOFMYFVSA-M |
| XLogP | 1.05 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|