C24H23NO7S — CID 126214834
[4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 126214834) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is [4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126214834 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [4-[(E)-[3-[2-(2-methylpropoxy)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C3/SC(=O)N(CC(=O)OCC(C)C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H23NO7S/c1-15(2)14-31-21(26)13-25-22(27)20(33-24(25)29)12-16-4-8-19(9-5-16)32-23(28)17-6-10-18(30-3)11-7-17/h4-12,15H,13-14H2,1-3H3/b20-12+ |
| InChIKey | HFPPXIQFYXNQMK-UDWIEESQSA-N |
| XLogP | 4.15 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|