C19H15NO5S — CID 126317038
[4-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate (PubChem CID 126317038) has the molecular formula C19H15NO5S and a molecular weight of 369.40 g/mol. Its IUPAC name is [4-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126317038 |
| Molecular Formula | C19H15NO5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | [4-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C3/SC(=O)N(C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C19H15NO5S/c1-20-17(21)16(26-19(20)23)11-12-3-7-15(8-4-12)25-18(22)13-5-9-14(24-2)10-6-13/h3-11H,1-2H3/b16-11+ |
| InChIKey | XDJBUOOFLACRTO-LFIBNONCSA-N |
| XLogP | 3.58 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|