C27H21ClN2O7S — CID 126282276
[4-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 126282276) has the molecular formula C27H21ClN2O7S and a molecular weight of 552.99 g/mol. Its IUPAC name is [4-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126282276 |
| Molecular Formula | C27H21ClN2O7S |
| Molecular Weight | 552.99 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | [4-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccc(OC)c(Cl)c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H21ClN2O7S/c1-35-19-10-5-17(6-11-19)26(33)37-20-8-3-16(4-9-20)13-23-25(32)30(27(34)38-23)15-24(31)29-18-7-12-22(36-2)21(28)14-18/h3-14H,15H2,1-2H3,(H,29,31)/b23-13+ |
| InChIKey | YTTKGGFNWGNCCM-YDZHTSKRSA-N |
| XLogP | 5.25 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.99 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|