C21H20ClN3O4S — CID 3989492
N-(3-chloro-4-methoxyphenyl)-2-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 3989492) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3989492 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)SC(=Cc3ccc(N(C)C)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C21H20ClN3O4S/c1-24(2)15-7-4-13(5-8-15)10-18-20(27)25(21(28)30-18)12-19(26)23-14-6-9-17(29-3)16(22)11-14/h4-11H,12H2,1-3H3,(H,23,26) |
| InChIKey | SNAVWQWNNRQDJK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|