C24H23ClN2O8S — CID 126280690
ethyl 2-[5-[(Z)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 126280690) has the molecular formula C24H23ClN2O8S and a molecular weight of 534.97 g/mol. Its IUPAC name is ethyl 2-[5-[(Z)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-[(Z)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126280690 |
| Molecular Formula | C24H23ClN2O8S |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | ethyl 2-[5-[(Z)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(OC)c(Cl)c3)C2=O)ccc1OC |
| InChI | InChI=1S/C24H23ClN2O8S/c1-4-34-22(29)13-35-19-9-14(5-7-18(19)33-3)10-20-23(30)27(24(31)36-20)12-21(28)26-15-6-8-17(32-2)16(25)11-15/h5-11H,4,12-13H2,1-3H3,(H,26,28)/b20-10- |
| InChIKey | PBXDPMYZXBVEKZ-JMIUGGIZSA-N |
| XLogP | 3.97 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|