C23H20BrClN2O7S — CID 126275799
ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126275799) has the molecular formula C23H20BrClN2O7S and a molecular weight of 583.84 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126275799 |
| Molecular Formula | C23H20BrClN2O7S |
| Molecular Weight | 583.84 g/mol |
| Exact Mass | 581.99 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1/C=C1/SC(=O)N(CC(=O)Nc2ccc(OC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C23H20BrClN2O7S/c1-3-33-21(29)12-34-17-6-4-14(24)8-13(17)9-19-22(30)27(23(31)35-19)11-20(28)26-15-5-7-18(32-2)16(25)10-15/h4-10H,3,11-12H2,1-2H3,(H,26,28)/b19-9+ |
| InChIKey | DEOVKCJSJGUHRE-DJKKODMXSA-N |
| XLogP | 4.73 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|