C21H16BrClN2O6S — CID 126181415
methyl 2-[4-bromo-2-[(E)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126181415) has the molecular formula C21H16BrClN2O6S and a molecular weight of 539.79 g/mol. Its IUPAC name is methyl 2-[4-bromo-2-[(E)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-bromo-2-[(E)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126181415 |
| Molecular Formula | C21H16BrClN2O6S |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 537.96 |
| IUPAC Name | methyl 2-[4-bromo-2-[(E)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(Br)cc1/C=C1/SC(=O)N(CC(=O)Nc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C21H16BrClN2O6S/c1-30-19(27)11-31-16-7-2-13(22)8-12(16)9-17-20(28)25(21(29)32-17)10-18(26)24-15-5-3-14(23)4-6-15/h2-9H,10-11H2,1H3,(H,24,26)/b17-9+ |
| InChIKey | QLMUOCAIRTZPFC-RQZCQDPDSA-N |
| XLogP | 4.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|