C29H25BrClN3O5S — CID 126148477
2-[(5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 126148477) has the molecular formula C29H25BrClN3O5S and a molecular weight of 642.96 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126148477 |
| Molecular Formula | C29H25BrClN3O5S |
| Molecular Weight | 642.96 g/mol |
| Exact Mass | 641.04 |
| IUPAC Name | 2-[(5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(Br)ccc2OCc2ccc(Cl)cc2)C1=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C29H25BrClN3O5S/c30-21-3-10-25(39-18-19-1-4-22(31)5-2-19)20(15-21)16-26-28(36)34(29(37)40-26)17-27(35)32-23-6-8-24(9-7-23)33-11-13-38-14-12-33/h1-10,15-16H,11-14,17-18H2,(H,32,35)/b26-16+ |
| InChIKey | CAAZVISLIPEYAA-WGOQTCKBSA-N |
| XLogP | 6.19 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.96 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|