C16H16BrNO5S — CID 2189982
ethyl 2-[4-bromo-2-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 2189982) has the molecular formula C16H16BrNO5S and a molecular weight of 414.28 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2189982 |
| Molecular Formula | C16H16BrNO5S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1/C=C1/SC(=O)N(CC)C1=O |
| InChI | InChI=1S/C16H16BrNO5S/c1-3-18-15(20)13(24-16(18)21)8-10-7-11(17)5-6-12(10)23-9-14(19)22-4-2/h5-8H,3-4,9H2,1-2H3/b13-8+ |
| InChIKey | VDMMYCCWZMLQNC-MDWZMJQESA-N |
| XLogP | 3.45 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|