C21H18BrNO5S — CID 124663671
ethyl 2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-bromophenoxy]acetate (PubChem CID 124663671) has the molecular formula C21H18BrNO5S and a molecular weight of 476.35 g/mol. Its IUPAC name is ethyl 2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-bromophenoxy]acetate.
| Compound Name | ethyl 2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-bromophenoxy]acetate |
|---|---|
| PubChem CID | 124663671 |
| Molecular Formula | C21H18BrNO5S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | ethyl 2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-bromophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1/C=C1/SC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H18BrNO5S/c1-2-27-19(24)13-28-17-9-8-16(22)10-15(17)11-18-20(25)23(21(26)29-18)12-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3/b18-11+ |
| InChIKey | UWNHNLCZYYUOSH-WOJGMQOQSA-N |
| XLogP | 4.63 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|