C22H18BrFN2O6S — CID 126241939
ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126241939) has the molecular formula C22H18BrFN2O6S and a molecular weight of 537.36 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126241939 |
| Molecular Formula | C22H18BrFN2O6S |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1/C=C1/SC(=O)N(CC(=O)Nc2cccc(F)c2)C1=O |
| InChI | InChI=1S/C22H18BrFN2O6S/c1-2-31-20(28)12-32-17-7-6-14(23)8-13(17)9-18-21(29)26(22(30)33-18)11-19(27)25-16-5-3-4-15(24)10-16/h3-10H,2,11-12H2,1H3,(H,25,27)/b18-9+ |
| InChIKey | QFRAEZRMAQICHK-GIJQJNRQSA-N |
| XLogP | 4.21 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|