C23H19BrN2O8S — CID 126157043
ethyl 2-[2-[(E)-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-bromophenoxy]acetate (PubChem CID 126157043) has the molecular formula C23H19BrN2O8S and a molecular weight of 563.38 g/mol. Its IUPAC name is ethyl 2-[2-[(E)-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-bromophenoxy]acetate.
| Compound Name | ethyl 2-[2-[(E)-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-bromophenoxy]acetate |
|---|---|
| PubChem CID | 126157043 |
| Molecular Formula | C23H19BrN2O8S |
| Molecular Weight | 563.38 g/mol |
| Exact Mass | 562.00 |
| IUPAC Name | ethyl 2-[2-[(E)-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-4-bromophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1/C=C1/SC(=O)N(CC(=O)Nc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C23H19BrN2O8S/c1-2-31-21(28)11-32-16-5-3-14(24)7-13(16)8-19-22(29)26(23(30)35-19)10-20(27)25-15-4-6-17-18(9-15)34-12-33-17/h3-9H,2,10-12H2,1H3,(H,25,27)/b19-8+ |
| InChIKey | DMGBORUCDOPAHH-UFWORHAWSA-N |
| XLogP | 3.79 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|