C18H12BrFN2O4S — CID 126235375
2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126235375) has the molecular formula C18H12BrFN2O4S and a molecular weight of 451.27 g/mol. Its IUPAC name is 2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126235375 |
| Molecular Formula | C18H12BrFN2O4S |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(Br)ccc2O)C1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C18H12BrFN2O4S/c19-11-4-5-14(23)10(6-11)7-15-17(25)22(18(26)27-15)9-16(24)21-13-3-1-2-12(20)8-13/h1-8,23H,9H2,(H,21,24)/b15-7+ |
| InChIKey | KVKTVAKPTVADMJ-VIZOYTHASA-N |
| XLogP | 3.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|