C19H12BrFN2O5S — CID 126236099
2-[(5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126236099) has the molecular formula C19H12BrFN2O5S and a molecular weight of 479.28 g/mol. Its IUPAC name is 2-[(5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126236099 |
| Molecular Formula | C19H12BrFN2O5S |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | 2-[(5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cc3c(cc2Br)OCO3)C1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H12BrFN2O5S/c20-13-7-15-14(27-9-28-15)4-10(13)5-16-18(25)23(19(26)29-16)8-17(24)22-12-3-1-2-11(21)6-12/h1-7H,8-9H2,(H,22,24)/b16-5- |
| InChIKey | VYIFYJBHJWTVPZ-BNCCVWRVSA-N |
| XLogP | 3.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|