C26H19FN2O6S — CID 126172426
N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126172426) has the molecular formula C26H19FN2O6S and a molecular weight of 506.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126172426 |
| Molecular Formula | C26H19FN2O6S |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccccc2OCc2ccccc2F)C1=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H19FN2O6S/c27-19-7-3-1-6-17(19)14-33-20-8-4-2-5-16(20)11-23-25(31)29(26(32)36-23)13-24(30)28-18-9-10-21-22(12-18)35-15-34-21/h1-12H,13-15H2,(H,28,30)/b23-11+ |
| InChIKey | CUCRDXYSVKWSQE-FOKLQQMPSA-N |
| XLogP | 4.81 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|