C19H12BrCl2NO5S — CID 3643565
2-[4-bromo-2-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 3643565) has the molecular formula C19H12BrCl2NO5S and a molecular weight of 517.18 g/mol. Its IUPAC name is 2-[4-bromo-2-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 3643565 |
| Molecular Formula | C19H12BrCl2NO5S |
| Molecular Weight | 517.18 g/mol |
| Exact Mass | 514.90 |
| IUPAC Name | 2-[4-bromo-2-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Br)cc1C=C1SC(=O)N(Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H12BrCl2NO5S/c20-12-2-4-15(28-9-17(24)25)11(6-12)7-16-18(26)23(19(27)29-16)8-10-1-3-13(21)14(22)5-10/h1-7H,8-9H2,(H,24,25) |
| InChIKey | CUOZADIQENXMLV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.18 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|