C21H19ClN2O6S — CID 4566180
N-(3-chloro-4-methoxyphenyl)-2-[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 4566180) has the molecular formula C21H19ClN2O6S and a molecular weight of 462.91 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 4566180 |
| Molecular Formula | C21H19ClN2O6S |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCOc1cc(C=C2SC(=O)N(CC(=O)Nc3ccc(OC)c(Cl)c3)C2=O)ccc1O |
| InChI | InChI=1S/C21H19ClN2O6S/c1-3-30-17-8-12(4-6-15(17)25)9-18-20(27)24(21(28)31-18)11-19(26)23-13-5-7-16(29-2)14(22)10-13/h4-10,25H,3,11H2,1-2H3,(H,23,26) |
| InChIKey | AOTOMGVNCOSRQL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|