C20H16ClN3O8S — CID 4999001
N-(3-chloro-4-methoxyphenyl)-2-[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 4999001) has the molecular formula C20H16ClN3O8S and a molecular weight of 493.88 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 4999001 |
| Molecular Formula | C20H16ClN3O8S |
| Molecular Weight | 493.88 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)SC(=Cc3cc(OC)c(O)c([N+](=O)[O-])c3)C2=O)cc1Cl |
| InChI | InChI=1S/C20H16ClN3O8S/c1-31-14-4-3-11(8-12(14)21)22-17(25)9-23-19(27)16(33-20(23)28)7-10-5-13(24(29)30)18(26)15(6-10)32-2/h3-8,26H,9H2,1-2H3,(H,22,25) |
| InChIKey | SOUFBKVEJDOGHD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|