C23H17N3O7S — CID 126368386
2-[(5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide (PubChem CID 126368386) has the molecular formula C23H17N3O7S and a molecular weight of 479.47 g/mol. Its IUPAC name is 2-[(5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126368386 |
| Molecular Formula | C23H17N3O7S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 2-[(5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc4ccccc34)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C23H17N3O7S/c1-33-18-10-13(9-17(21(18)28)26(31)32)11-19-22(29)25(23(30)34-19)12-20(27)24-16-8-4-6-14-5-2-3-7-15(14)16/h2-11,28H,12H2,1H3,(H,24,27)/b19-11+ |
| InChIKey | WOEQGVXMJGBTDH-YBFXNURJSA-N |
| XLogP | 4.14 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|