C18H12Cl2N2O6S — CID 124665984
(5E)-3-[(2,6-dichlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124665984) has the molecular formula C18H12Cl2N2O6S and a molecular weight of 455.28 g/mol. Its IUPAC name is (5E)-3-[(2,6-dichlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2,6-dichlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124665984 |
| Molecular Formula | C18H12Cl2N2O6S |
| Molecular Weight | 455.28 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | (5E)-3-[(2,6-dichlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H12Cl2N2O6S/c1-28-14-6-9(5-13(16(14)23)22(26)27)7-15-17(24)21(18(25)29-15)8-10-11(19)3-2-4-12(10)20/h2-7,23H,8H2,1H3/b15-7+ |
| InChIKey | HQPDTODRFWGSAZ-VIZOYTHASA-N |
| XLogP | 4.85 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|