C19H14ClFN2O6S — CID 4100767
3-[(2-chloro-6-fluorophenyl)methyl]-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 4100767) has the molecular formula C19H14ClFN2O6S and a molecular weight of 452.85 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methyl]-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methyl]-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4100767 |
| Molecular Formula | C19H14ClFN2O6S |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methyl]-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2SC(=O)N(Cc3c(F)cccc3Cl)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H14ClFN2O6S/c1-2-29-15-7-10(6-14(17(15)24)23(27)28)8-16-18(25)22(19(26)30-16)9-11-12(20)4-3-5-13(11)21/h3-8,24H,2,9H2,1H3 |
| InChIKey | PYSQHDWYBFNPHS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|