C18H13ClN2O6S — CID 2904479
3-[(2-chlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2904479) has the molecular formula C18H13ClN2O6S and a molecular weight of 420.83 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2-chlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2904479 |
| Molecular Formula | C18H13ClN2O6S |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(C=C2SC(=O)N(Cc3ccccc3Cl)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H13ClN2O6S/c1-27-14-7-10(6-13(16(14)22)21(25)26)8-15-17(23)20(18(24)28-15)9-11-4-2-3-5-12(11)19/h2-8,22H,9H2,1H3 |
| InChIKey | JBQCZFLSJFQVNB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|