C17H9ClFI2NO3S — CID 4051444
3-[(2-chloro-6-fluorophenyl)methyl]-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 4051444) has the molecular formula C17H9ClFI2NO3S and a molecular weight of 615.59 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methyl]-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methyl]-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4051444 |
| Molecular Formula | C17H9ClFI2NO3S |
| Molecular Weight | 615.59 g/mol |
| Exact Mass | 614.81 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methyl]-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2cc(I)c(O)c(I)c2)C(=O)N1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H9ClFI2NO3S/c18-10-2-1-3-11(19)9(10)7-22-16(24)14(26-17(22)25)6-8-4-12(20)15(23)13(21)5-8/h1-6,23H,7H2 |
| InChIKey | XWMXRZUWUMBVOC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|