C17H10BrClFNO2S — CID 3353219
5-[(4-bromophenyl)methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 3353219) has the molecular formula C17H10BrClFNO2S and a molecular weight of 426.69 g/mol. Its IUPAC name is 5-[(4-bromophenyl)methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-bromophenyl)methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3353219 |
| Molecular Formula | C17H10BrClFNO2S |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | 5-[(4-bromophenyl)methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(Br)cc2)C(=O)N1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H10BrClFNO2S/c18-11-6-4-10(5-7-11)8-15-16(22)21(17(23)24-15)9-12-13(19)2-1-3-14(12)20/h1-8H,9H2 |
| InChIKey | REDXJYHEPVJACY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|