C17H11Cl2NO2S — CID 4085356
5-benzylidene-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 4085356) has the molecular formula C17H11Cl2NO2S and a molecular weight of 364.25 g/mol. Its IUPAC name is 5-benzylidene-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-benzylidene-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4085356 |
| Molecular Formula | C17H11Cl2NO2S |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 5-benzylidene-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccccc2)C(=O)N1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H11Cl2NO2S/c18-13-7-4-8-14(19)12(13)10-20-16(21)15(23-17(20)22)9-11-5-2-1-3-6-11/h1-9H,10H2 |
| InChIKey | WTGNROQMLGDYKU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|