C20H19NO2S — CID 1206204
5-benzylidene-3-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 1206204) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is 5-benzylidene-3-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-benzylidene-3-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1206204 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-benzylidene-3-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(C)c(CN2C(=O)SC(=Cc3ccccc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H19NO2S/c1-13-9-14(2)17(15(3)10-13)12-21-19(22)18(24-20(21)23)11-16-7-5-4-6-8-16/h4-11H,12H2,1-3H3 |
| InChIKey | GLHZKSANCMWBRU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|