C12H13N2O2S+ — CID 3596061
2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethylazanium (PubChem CID 3596061) has the molecular formula C12H13N2O2S+ and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethylazanium.
| Compound Name | 2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethylazanium |
|---|---|
| PubChem CID | 3596061 |
| Molecular Formula | C12H13N2O2S+ |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethylazanium |
| SMILES | [NH3+]CCN1C(=O)SC(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C12H12N2O2S/c13-6-7-14-11(15)10(17-12(14)16)8-9-4-2-1-3-5-9/h1-5,8H,6-7,13H2/p+1 |
| InChIKey | IVEJXGNFULDNLM-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|