C16H19N2O2S+ — CID 2243744
(5Z)-5-benzylidene-3-(piperidin-1-ium-1-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 2243744) has the molecular formula C16H19N2O2S+ and a molecular weight of 303.41 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3-(piperidin-1-ium-1-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-benzylidene-3-(piperidin-1-ium-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2243744 |
| Molecular Formula | C16H19N2O2S+ |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (5Z)-5-benzylidene-3-(piperidin-1-ium-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccccc2)C(=O)N1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C16H18N2O2S/c19-15-14(11-13-7-3-1-4-8-13)21-16(20)18(15)12-17-9-5-2-6-10-17/h1,3-4,7-8,11H,2,5-6,9-10,12H2/p+1/b14-11- |
| InChIKey | JJJVVECCJQYOGA-KAMYIIQDSA-O |
| XLogP | 1.75 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|